C18H20F6O4SSe — CID 139266201
[10,10-dimethyl-3-[4-(trifluoromethyl)phenyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl] trifluoromethanesulfonate (PubChem CID 139266201) has the molecular formula C18H20F6O4SSe and a molecular weight of 525.37 g/mol. Its IUPAC name is [10,10-dimethyl-3-[4-(trifluoromethyl)phenyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl] trifluoromethanesulfonate.
| Compound Name | [10,10-dimethyl-3-[4-(trifluoromethyl)phenyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 139266201 |
| Molecular Formula | C18H20F6O4SSe |
| Molecular Weight | 525.37 g/mol |
| Exact Mass | 526.02 |
| IUPAC Name | [10,10-dimethyl-3-[4-(trifluoromethyl)phenyl]-4-oxa-3λ4-selenatricyclo[5.2.1.01,5]decan-3-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)C2CCC13C[Se](OS(=O)(=O)C(F)(F)F)(c1ccc(C(F)(F)F)cc1)OC3C2 |
| InChI | InChI=1S/C18H20F6O4SSe/c1-15(2)12-7-8-16(15)10-30(27-14(16)9-12,28-29(25,26)18(22,23)24)13-5-3-11(4-6-13)17(19,20)21/h3-6,12,14H,7-10H2,1-2H3 |
| InChIKey | QYSCWNQOUJOWNS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|