C16H26N2 — CID 134889394
(1R,2S,3S,6R,7R,8S)-3,6-diethyl-12,12-dimethyl-4,5-diazatetracyclo[6.2.1.13,6.02,7]dodec-4-ene (PubChem CID 134889394) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (1R,2S,3S,6R,7R,8S)-3,6-diethyl-12,12-dimethyl-4,5-diazatetracyclo[6.2.1.13,6.02,7]dodec-4-ene.
| Compound Name | (1R,2S,3S,6R,7R,8S)-3,6-diethyl-12,12-dimethyl-4,5-diazatetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
|---|---|
| PubChem CID | 134889394 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (1R,2S,3S,6R,7R,8S)-3,6-diethyl-12,12-dimethyl-4,5-diazatetracyclo[6.2.1.13,6.02,7]dodec-4-ene |
| SMILES | CC[C@]12N=N[C@](CC)([C@@H]3[C@H]4CC[C@H](C4)[C@@H]31)C2(C)C |
| InChI | InChI=1S/C16H26N2/c1-5-15-12-10-7-8-11(9-10)13(12)16(6-2,18-17-15)14(15,3)4/h10-13H,5-9H2,1-4H3/t10-,11+,12+,13-,15+,16- |
| InChIKey | YFQKPGABLKNXJJ-JKUBHESRSA-N |
| XLogP | 4.45 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|