C11H16F3NO — CID 134892031
N-(1-adamantyloxy)-1,1,1-trifluoromethanamine (PubChem CID 134892031) has the molecular formula C11H16F3NO and a molecular weight of 235.25 g/mol. Its IUPAC name is N-(1-adamantyloxy)-1,1,1-trifluoromethanamine.
| Compound Name | N-(1-adamantyloxy)-1,1,1-trifluoromethanamine |
|---|---|
| PubChem CID | 134892031 |
| Molecular Formula | C11H16F3NO |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | N-(1-adamantyloxy)-1,1,1-trifluoromethanamine |
| SMILES | FC(F)(F)NOC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C11H16F3NO/c12-11(13,14)15-16-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9,15H,1-6H2 |
| InChIKey | WLKGYYODAUKBEV-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|