C18H28O5 — CID 134916400
methyl (1S,2R,3S,5S)-2-methyl-3-[(E)-2-(oxan-2-yloxy)ethenoxy]-5-prop-1-en-2-ylcyclopentane-1-carboxylate (PubChem CID 134916400) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is methyl (1S,2R,3S,5S)-2-methyl-3-[(E)-2-(oxan-2-yloxy)ethenoxy]-5-prop-1-en-2-ylcyclopentane-1-carboxylate.
| Compound Name | methyl (1S,2R,3S,5S)-2-methyl-3-[(E)-2-(oxan-2-yloxy)ethenoxy]-5-prop-1-en-2-ylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 134916400 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | methyl (1S,2R,3S,5S)-2-methyl-3-[(E)-2-(oxan-2-yloxy)ethenoxy]-5-prop-1-en-2-ylcyclopentane-1-carboxylate |
| SMILES | C=C(C)[C@H]1C[C@H](O/C=C/OC2CCCCO2)[C@H](C)[C@H]1C(=O)OC |
| InChI | InChI=1S/C18H28O5/c1-12(2)14-11-15(13(3)17(14)18(19)20-4)21-9-10-23-16-7-5-6-8-22-16/h9-10,13-17H,1,5-8,11H2,2-4H3/b10-9+/t13-,14+,15-,16?,17+/m0/s1 |
| InChIKey | OWHIBPZSXNTFBE-PXXGEEOKSA-N |
| XLogP | 3.41 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|