About hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium
hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium (PubChem CID 134919753) has the molecular formula C11H16Cl6NOSb
and a molecular weight of 512.73 g/mol. Its IUPAC name is hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium.
Molecular Properties
| Compound Name | hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium |
| PubChem CID | 134919753 |
| Molecular Formula | C11H16Cl6NOSb |
| Molecular Weight | 512.73 g/mol |
| Exact Mass | 508.84 |
| IUPAC Name | hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium |
| SMILES | CC(C)O/C=[N+](\C)c1ccccc1.Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H16NO.6ClH.Sb/c1-10(2)13-9-12(3)11-7-5-4-6-8-11;;;;;;;/h4-10H,1-3H3;6*1H;/q+1;;;;;;;+5/p-6/b12-9+;;;;;;; |
| InChIKey | HXBOOJAJTSVFKQ-ARACNKMWSA-H |
| XLogP | 6.17 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 512.73 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium?
The IUPAC name of hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium (CID 134919753) is hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium.
What is the SMILES notation for hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium?
The canonical SMILES for hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium is CC(C)O/C=[N+](\C)c1ccccc1.Cl[Sb-](Cl)(Cl)(Cl)(Cl)Cl.
What is the InChIKey of hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium?
The InChIKey is HXBOOJAJTSVFKQ-ARACNKMWSA-H. The full InChI is InChI=1S/C11H16NO.6ClH.Sb/c1-10(2)13-9-12(3)11-7-5-4-6-8-11;;;;;;;/h4-10H,1-3H3;6*1H;/q+1;;;;;;;+5/p-6/b12-9+;;;;;;;.
What are the key properties of hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium?
hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium has a molecular weight of 512.73 g/mol, XLogP of 6.17, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hexachloroantimony(1-);methyl-phenyl-(propan-2-yloxymethylidene)azanium is sourced from PubChem (CID 134919753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).