C9H17N — CID 134923809
3-ethyl-3,6-dimethyl-4,5-dihydro-2H-pyridine (PubChem CID 134923809) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is 3-ethyl-3,6-dimethyl-4,5-dihydro-2H-pyridine.
| Compound Name | 3-ethyl-3,6-dimethyl-4,5-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 134923809 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 3-ethyl-3,6-dimethyl-4,5-dihydro-2H-pyridine |
| SMILES | CCC1(C)CCC(C)=NC1 |
| InChI | InChI=1S/C9H17N/c1-4-9(3)6-5-8(2)10-7-9/h4-7H2,1-3H3 |
| InChIKey | JSAQDDICYYBGBD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |