C22H18Br2O2S2 — CID 134929835
5-[bis[(4-bromophenyl)methylsulfanyl]methyl]-1,3-benzodioxole (PubChem CID 134929835) has the molecular formula C22H18Br2O2S2 and a molecular weight of 538.33 g/mol. Its IUPAC name is 5-[bis[(4-bromophenyl)methylsulfanyl]methyl]-1,3-benzodioxole.
| Compound Name | 5-[bis[(4-bromophenyl)methylsulfanyl]methyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 134929835 |
| Molecular Formula | C22H18Br2O2S2 |
| Molecular Weight | 538.33 g/mol |
| Exact Mass | 535.91 |
| IUPAC Name | 5-[bis[(4-bromophenyl)methylsulfanyl]methyl]-1,3-benzodioxole |
| SMILES | Brc1ccc(CSC(SCc2ccc(Br)cc2)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H18Br2O2S2/c23-18-6-1-15(2-7-18)12-27-22(28-13-16-3-8-19(24)9-4-16)17-5-10-20-21(11-17)26-14-25-20/h1-11,22H,12-14H2 |
| InChIKey | PKDLWZGUMSUGCT-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.33 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|