C20H46O3Si2 — CID 134931135
(3R,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylheptan-3-ol (PubChem CID 134931135) has the molecular formula C20H46O3Si2 and a molecular weight of 390.76 g/mol. Its IUPAC name is (3R,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylheptan-3-ol.
| Compound Name | (3R,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylheptan-3-ol |
|---|---|
| PubChem CID | 134931135 |
| Molecular Formula | C20H46O3Si2 |
| Molecular Weight | 390.76 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | (3R,5S,6S)-5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-6-methylheptan-3-ol |
| SMILES | CC[C@@H](O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H46O3Si2/c1-13-17(21)14-18(23-25(11,12)20(6,7)8)16(2)15-22-24(9,10)19(3,4)5/h16-18,21H,13-15H2,1-12H3/t16-,17+,18-/m0/s1 |
| InChIKey | RJXJNRQTMBDHME-KSZLIROESA-N |
| XLogP | 6.20 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.76 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|