C25H34O6Si — CID 134931194
[(3S,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dihydroxy-5-methyloxan-3-yl] acetate (PubChem CID 134931194) has the molecular formula C25H34O6Si and a molecular weight of 458.63 g/mol. Its IUPAC name is [(3S,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dihydroxy-5-methyloxan-3-yl] acetate.
| Compound Name | [(3S,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dihydroxy-5-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 134931194 |
| Molecular Formula | C25H34O6Si |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | [(3S,4S,5R,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,4-dihydroxy-5-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C(O)O[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](C)[C@@H]1O |
| InChI | InChI=1S/C25H34O6Si/c1-17-21(31-24(28)23(22(17)27)30-18(2)26)16-29-32(25(3,4)5,19-12-8-6-9-13-19)20-14-10-7-11-15-20/h6-15,17,21-24,27-28H,16H2,1-5H3/t17-,21-,22-,23-,24?/m0/s1 |
| InChIKey | REDPCEYLBJRFDI-RRQSPBLESA-N |
| XLogP | 2.21 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|