C30H54O5Si2 — CID 134939567
3-[(2S,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(1S)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxypropyl]oxan-2-yl]propanal (PubChem CID 134939567) has the molecular formula C30H54O5Si2 and a molecular weight of 550.93 g/mol. Its IUPAC name is 3-[(2S,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(1S)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxypropyl]oxan-2-yl]propanal.
| Compound Name | 3-[(2S,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(1S)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxypropyl]oxan-2-yl]propanal |
|---|---|
| PubChem CID | 134939567 |
| Molecular Formula | C30H54O5Si2 |
| Molecular Weight | 550.93 g/mol |
| Exact Mass | 550.35 |
| IUPAC Name | 3-[(2S,3R,6S)-3-[tert-butyl(dimethyl)silyl]oxy-6-[(1S)-3-[tert-butyl(dimethyl)silyl]oxy-1-phenylmethoxypropyl]oxan-2-yl]propanal |
| SMILES | CC(C)(C)[Si](C)(C)OCC[C@H](OCc1ccccc1)[C@@H]1CC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCC=O)O1 |
| InChI | InChI=1S/C30H54O5Si2/c1-29(2,3)36(7,8)33-22-20-25(32-23-24-15-12-11-13-16-24)27-18-19-28(26(34-27)17-14-21-31)35-37(9,10)30(4,5)6/h11-13,15-16,21,25-28H,14,17-20,22-23H2,1-10H3/t25-,26-,27-,28+/m0/s1 |
| InChIKey | LREUBWONMVHDRX-LAJGZZDBSA-N |
| XLogP | 7.90 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.93 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|