About fluorobenzene;iodobenzene;yttrium
fluorobenzene;iodobenzene;yttrium (PubChem CID 134939677) has the molecular formula C12H8FIY-2
and a molecular weight of 387.00 g/mol. Its IUPAC name is fluorobenzene;iodobenzene;yttrium.
Molecular Properties
| Compound Name | fluorobenzene;iodobenzene;yttrium |
| PubChem CID | 134939677 |
| Molecular Formula | C12H8FIY-2 |
| Molecular Weight | 387.00 g/mol |
| Exact Mass | 386.87 |
| IUPAC Name | fluorobenzene;iodobenzene;yttrium |
| SMILES | Fc1[c-]cccc1.Ic1[c-]cccc1.[Y] |
| InChI | InChI=1S/C6H4F.C6H4I.Y/c2*7-6-4-2-1-3-5-6;/h2*1-4H;/q2*-1; |
| InChIKey | RUBOHCUJMVDHTR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.00 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze fluorobenzene;iodobenzene;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorobenzene;iodobenzene;yttrium?
The IUPAC name of fluorobenzene;iodobenzene;yttrium (CID 134939677) is fluorobenzene;iodobenzene;yttrium.
What is the SMILES notation for fluorobenzene;iodobenzene;yttrium?
The canonical SMILES for fluorobenzene;iodobenzene;yttrium is Fc1[c-]cccc1.Ic1[c-]cccc1.[Y].
What is the InChIKey of fluorobenzene;iodobenzene;yttrium?
The InChIKey is RUBOHCUJMVDHTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4F.C6H4I.Y/c2*7-6-4-2-1-3-5-6;/h2*1-4H;/q2*-1;.
What are the key properties of fluorobenzene;iodobenzene;yttrium?
fluorobenzene;iodobenzene;yttrium has a molecular weight of 387.00 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for fluorobenzene;iodobenzene;yttrium is sourced from PubChem (CID 134939677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).