About 1,3-difluorobenzene-2-ide;yttrium
1,3-difluorobenzene-2-ide;yttrium (PubChem CID 58618905) has the molecular formula C6H3F2Y-
and a molecular weight of 201.99 g/mol. Its IUPAC name is 1,3-difluorobenzene-2-ide;yttrium.
Molecular Properties
| Compound Name | 1,3-difluorobenzene-2-ide;yttrium |
| PubChem CID | 58618905 |
| Molecular Formula | C6H3F2Y- |
| Molecular Weight | 201.99 g/mol |
| Exact Mass | 201.93 |
| IUPAC Name | 1,3-difluorobenzene-2-ide;yttrium |
| SMILES | Fc1[c-]c(F)ccc1.[Y] |
| InChI | InChI=1S/C6H3F2.Y/c7-5-2-1-3-6(8)4-5;/h1-3H;/q-1; |
| InChIKey | XYNBODMAOZYBTI-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.99 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,3-difluorobenzene-2-ide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluorobenzene-2-ide;yttrium?
The IUPAC name of 1,3-difluorobenzene-2-ide;yttrium (CID 58618905) is 1,3-difluorobenzene-2-ide;yttrium.
What is the SMILES notation for 1,3-difluorobenzene-2-ide;yttrium?
The canonical SMILES for 1,3-difluorobenzene-2-ide;yttrium is Fc1[c-]c(F)ccc1.[Y].
What is the InChIKey of 1,3-difluorobenzene-2-ide;yttrium?
The InChIKey is XYNBODMAOZYBTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F2.Y/c7-5-2-1-3-6(8)4-5;/h1-3H;/q-1;.
What are the key properties of 1,3-difluorobenzene-2-ide;yttrium?
1,3-difluorobenzene-2-ide;yttrium has a molecular weight of 201.99 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluorobenzene-2-ide;yttrium is sourced from PubChem (CID 58618905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).