About cadmium(2+);bis(1,3-difluorobenzene-2-ide)
cadmium(2+);bis(1,3-difluorobenzene-2-ide) (PubChem CID 177497167) has the molecular formula C12H6CdF4
and a molecular weight of 338.58 g/mol. Its IUPAC name is cadmium(2+);bis(1,3-difluorobenzene-2-ide).
Molecular Properties
| Compound Name | cadmium(2+);bis(1,3-difluorobenzene-2-ide) |
| PubChem CID | 177497167 |
| Molecular Formula | C12H6CdF4 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 339.94 |
| IUPAC Name | cadmium(2+);bis(1,3-difluorobenzene-2-ide) |
| SMILES | Fc1[c-]c(F)ccc1.Fc1[c-]c(F)ccc1.[Cd+2] |
| InChI | InChI=1S/2C6H3F2.Cd/c2*7-5-2-1-3-6(8)4-5;/h2*1-3H;/q2*-1;+2 |
| InChIKey | HXYCKYLUSJDMEP-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cadmium(2+);bis(1,3-difluorobenzene-2-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium(2+);bis(1,3-difluorobenzene-2-ide)?
The IUPAC name of cadmium(2+);bis(1,3-difluorobenzene-2-ide) (CID 177497167) is cadmium(2+);bis(1,3-difluorobenzene-2-ide).
What is the SMILES notation for cadmium(2+);bis(1,3-difluorobenzene-2-ide)?
The canonical SMILES for cadmium(2+);bis(1,3-difluorobenzene-2-ide) is Fc1[c-]c(F)ccc1.Fc1[c-]c(F)ccc1.[Cd+2].
What is the InChIKey of cadmium(2+);bis(1,3-difluorobenzene-2-ide)?
The InChIKey is HXYCKYLUSJDMEP-UHFFFAOYSA-N. The full InChI is InChI=1S/2C6H3F2.Cd/c2*7-5-2-1-3-6(8)4-5;/h2*1-3H;/q2*-1;+2.
What are the key properties of cadmium(2+);bis(1,3-difluorobenzene-2-ide)?
cadmium(2+);bis(1,3-difluorobenzene-2-ide) has a molecular weight of 338.58 g/mol, XLogP of 3.53, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium(2+);bis(1,3-difluorobenzene-2-ide) is sourced from PubChem (CID 177497167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).