About 1,3-difluorobenzene-2-ide;manganese
1,3-difluorobenzene-2-ide;manganese (PubChem CID 135025289) has the molecular formula C6H3F2Mn-
and a molecular weight of 168.02 g/mol. Its IUPAC name is 1,3-difluorobenzene-2-ide;manganese.
Molecular Properties
| Compound Name | 1,3-difluorobenzene-2-ide;manganese |
| PubChem CID | 135025289 |
| Molecular Formula | C6H3F2Mn- |
| Molecular Weight | 168.02 g/mol |
| Exact Mass | 167.96 |
| IUPAC Name | 1,3-difluorobenzene-2-ide;manganese |
| SMILES | Fc1[c-]c(F)ccc1.[Mn] |
| InChI | InChI=1S/C6H3F2.Mn/c7-5-2-1-3-6(8)4-5;/h1-3H;/q-1; |
| InChIKey | BLBIBMXVGORGBF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.02 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1,3-difluorobenzene-2-ide;manganese with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluorobenzene-2-ide;manganese?
The IUPAC name of 1,3-difluorobenzene-2-ide;manganese (CID 135025289) is 1,3-difluorobenzene-2-ide;manganese.
What is the SMILES notation for 1,3-difluorobenzene-2-ide;manganese?
The canonical SMILES for 1,3-difluorobenzene-2-ide;manganese is Fc1[c-]c(F)ccc1.[Mn].
What is the InChIKey of 1,3-difluorobenzene-2-ide;manganese?
The InChIKey is BLBIBMXVGORGBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3F2.Mn/c7-5-2-1-3-6(8)4-5;/h1-3H;/q-1;.
What are the key properties of 1,3-difluorobenzene-2-ide;manganese?
1,3-difluorobenzene-2-ide;manganese has a molecular weight of 168.02 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluorobenzene-2-ide;manganese is sourced from PubChem (CID 135025289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).