C14H25Cl5O2 — CID 134942256
(8R,9S,10S,11R,12S,13R)-8,9,10,12,13-pentachlorotetradecane-1,11-diol (PubChem CID 134942256) has the molecular formula C14H25Cl5O2 and a molecular weight of 402.62 g/mol. Its IUPAC name is (8R,9S,10S,11R,12S,13R)-8,9,10,12,13-pentachlorotetradecane-1,11-diol.
| Compound Name | (8R,9S,10S,11R,12S,13R)-8,9,10,12,13-pentachlorotetradecane-1,11-diol |
|---|---|
| PubChem CID | 134942256 |
| Molecular Formula | C14H25Cl5O2 |
| Molecular Weight | 402.62 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | (8R,9S,10S,11R,12S,13R)-8,9,10,12,13-pentachlorotetradecane-1,11-diol |
| SMILES | C[C@@H](Cl)[C@@H](Cl)[C@@H](O)[C@H](Cl)[C@@H](Cl)[C@H](Cl)CCCCCCCO |
| InChI | InChI=1S/C14H25Cl5O2/c1-9(15)11(17)14(21)13(19)12(18)10(16)7-5-3-2-4-6-8-20/h9-14,20-21H,2-8H2,1H3/t9-,10-,11-,12+,13-,14-/m1/s1 |
| InChIKey | OEGIZPHESTWNPS-YOVYLDAJSA-N |
| XLogP | 4.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|