About 2H-1,3-benzothiazol-2-ide;copper(1+);phosphane
2H-1,3-benzothiazol-2-ide;copper(1+);phosphane (PubChem CID 134942814) has the molecular formula C7H10CuNP2S
and a molecular weight of 265.72 g/mol. Its IUPAC name is 2H-1,3-benzothiazol-2-ide;copper(1+);phosphane.
Molecular Properties
| Compound Name | 2H-1,3-benzothiazol-2-ide;copper(1+);phosphane |
| PubChem CID | 134942814 |
| Molecular Formula | C7H10CuNP2S |
| Molecular Weight | 265.72 g/mol |
| Exact Mass | 264.93 |
| IUPAC Name | 2H-1,3-benzothiazol-2-ide;copper(1+);phosphane |
| SMILES | P.P.[Cu+].[c-]1nc2ccccc2s1 |
| InChI | InChI=1S/C7H4NS.Cu.2H3P/c1-2-4-7-6(3-1)8-5-9-7;;;/h1-4H;;2*1H3/q-1;+1;; |
| InChIKey | LMXBHLBQKWHTMR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.72 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2H-1,3-benzothiazol-2-ide;copper(1+);phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-1,3-benzothiazol-2-ide;copper(1+);phosphane?
The IUPAC name of 2H-1,3-benzothiazol-2-ide;copper(1+);phosphane (CID 134942814) is 2H-1,3-benzothiazol-2-ide;copper(1+);phosphane.
What is the SMILES notation for 2H-1,3-benzothiazol-2-ide;copper(1+);phosphane?
The canonical SMILES for 2H-1,3-benzothiazol-2-ide;copper(1+);phosphane is P.P.[Cu+].[c-]1nc2ccccc2s1.
What is the InChIKey of 2H-1,3-benzothiazol-2-ide;copper(1+);phosphane?
The InChIKey is LMXBHLBQKWHTMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4NS.Cu.2H3P/c1-2-4-7-6(3-1)8-5-9-7;;;/h1-4H;;2*1H3/q-1;+1;;.
What are the key properties of 2H-1,3-benzothiazol-2-ide;copper(1+);phosphane?
2H-1,3-benzothiazol-2-ide;copper(1+);phosphane has a molecular weight of 265.72 g/mol, XLogP of 2.21, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-1,3-benzothiazol-2-ide;copper(1+);phosphane is sourced from PubChem (CID 134942814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).