C7H4NS2Zn+ — CID 25200224
zinc 1,3-benzothiazole-2-thiolate (PubChem CID 25200224) has the molecular formula C7H4NS2Zn+ and a molecular weight of 231.64 g/mol. Its IUPAC name is zinc 1,3-benzothiazole-2-thiolate.
| Compound Name | zinc 1,3-benzothiazole-2-thiolate |
|---|---|
| PubChem CID | 25200224 |
| Molecular Formula | C7H4NS2Zn+ |
| Molecular Weight | 231.64 g/mol |
| Exact Mass | 229.91 |
| IUPAC Name | zinc 1,3-benzothiazole-2-thiolate |
| SMILES | [S-]c1nc2ccccc2s1.[Zn+2] |
| InChI | InChI=1S/C7H5NS2.Zn/c9-7-8-5-3-1-2-4-6(5)10-7;/h1-4H,(H,8,9);/q;+2/p-1 |
| InChIKey | JLKZUNOWPPEBPX-UHFFFAOYSA-M |
| XLogP | 2.20 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.64 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|