C25H32O7 — CID 134945797
(2R,6R,7R,8R,11R)-6-ethenyl-7-hydroxy-2-(hydroxymethyl)-11-(methoxymethoxy)-7-methyl-6-(phenylmethoxymethyl)-9-oxatricyclo[6.3.1.01,5]dodec-4-en-10-one (PubChem CID 134945797) has the molecular formula C25H32O7 and a molecular weight of 444.52 g/mol. Its IUPAC name is (2R,6R,7R,8R,11R)-6-ethenyl-7-hydroxy-2-(hydroxymethyl)-11-(methoxymethoxy)-7-methyl-6-(phenylmethoxymethyl)-9-oxatricyclo[6.3.1.01,5]dodec-4-en-10-one.
| Compound Name | (2R,6R,7R,8R,11R)-6-ethenyl-7-hydroxy-2-(hydroxymethyl)-11-(methoxymethoxy)-7-methyl-6-(phenylmethoxymethyl)-9-oxatricyclo[6.3.1.01,5]dodec-4-en-10-one |
|---|---|
| PubChem CID | 134945797 |
| Molecular Formula | C25H32O7 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (2R,6R,7R,8R,11R)-6-ethenyl-7-hydroxy-2-(hydroxymethyl)-11-(methoxymethoxy)-7-methyl-6-(phenylmethoxymethyl)-9-oxatricyclo[6.3.1.01,5]dodec-4-en-10-one |
| SMILES | C=C[C@]1(COCc2ccccc2)C2=CC[C@@H](CO)C23C[C@@H](OC(=O)[C@@H]3OCOC)[C@]1(C)O |
| InChI | InChI=1S/C25H32O7/c1-4-24(15-30-14-17-8-6-5-7-9-17)19-11-10-18(13-26)25(19)12-20(23(24,2)28)32-22(27)21(25)31-16-29-3/h4-9,11,18,20-21,26,28H,1,10,12-16H2,2-3H3/t18-,20+,21-,23-,24-,25?/m0/s1 |
| InChIKey | WLHOQLMLIXJFBB-QQLGMUDXSA-N |
| XLogP | 2.37 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|