C19H30O5Si — CID 134946593
(3aR,4R,8bR)-4-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-6,8b-dimethyl-4,5,8,8a-tetrahydro-1H-cyclopenta[e][2]benzofuran-3,7-dione (PubChem CID 134946593) has the molecular formula C19H30O5Si and a molecular weight of 366.53 g/mol. Its IUPAC name is (3aR,4R,8bR)-4-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-6,8b-dimethyl-4,5,8,8a-tetrahydro-1H-cyclopenta[e][2]benzofuran-3,7-dione.
| Compound Name | (3aR,4R,8bR)-4-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-6,8b-dimethyl-4,5,8,8a-tetrahydro-1H-cyclopenta[e][2]benzofuran-3,7-dione |
|---|---|
| PubChem CID | 134946593 |
| Molecular Formula | C19H30O5Si |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (3aR,4R,8bR)-4-[tert-butyl(dimethyl)silyl]oxy-3a-hydroxy-6,8b-dimethyl-4,5,8,8a-tetrahydro-1H-cyclopenta[e][2]benzofuran-3,7-dione |
| SMILES | CC1=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@]3(O)C(=O)OC[C@@]3(C)C2CC1=O |
| InChI | InChI=1S/C19H30O5Si/c1-11-12-8-15(24-25(6,7)17(2,3)4)19(22)16(21)23-10-18(19,5)13(12)9-14(11)20/h13,15,22H,8-10H2,1-7H3/t13?,15-,18+,19-/m1/s1 |
| InChIKey | GFJUOLCKXVDLOY-XSFAMKCDSA-N |
| XLogP | 2.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|