C24H35BO6 — CID 134946910
(1S,4R,9S,11R,12S,13R,18R,20S)-22-ethyl-11-hydroxy-9,16,16-trimethyl-15,17,21,23-tetraoxa-22-borahexacyclo[18.3.1.01,13.04,12.05,9.013,18]tetracos-5-en-8-one (PubChem CID 134946910) has the molecular formula C24H35BO6 and a molecular weight of 430.35 g/mol. Its IUPAC name is (1S,4R,9S,11R,12S,13R,18R,20S)-22-ethyl-11-hydroxy-9,16,16-trimethyl-15,17,21,23-tetraoxa-22-borahexacyclo[18.3.1.01,13.04,12.05,9.013,18]tetracos-5-en-8-one.
| Compound Name | (1S,4R,9S,11R,12S,13R,18R,20S)-22-ethyl-11-hydroxy-9,16,16-trimethyl-15,17,21,23-tetraoxa-22-borahexacyclo[18.3.1.01,13.04,12.05,9.013,18]tetracos-5-en-8-one |
|---|---|
| PubChem CID | 134946910 |
| Molecular Formula | C24H35BO6 |
| Molecular Weight | 430.35 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | (1S,4R,9S,11R,12S,13R,18R,20S)-22-ethyl-11-hydroxy-9,16,16-trimethyl-15,17,21,23-tetraoxa-22-borahexacyclo[18.3.1.01,13.04,12.05,9.013,18]tetracos-5-en-8-one |
| SMILES | CCB1O[C@H]2C[C@H]3OC(C)(C)OC[C@]34[C@H]3[C@H](O)C[C@]5(C)C(=O)CC=C5[C@@H]3CC[C@@]4(C2)O1 |
| InChI | InChI=1S/C24H35BO6/c1-5-25-30-14-10-19-24(13-28-21(2,3)29-19)20-15(8-9-23(24,11-14)31-25)16-6-7-18(27)22(16,4)12-17(20)26/h6,14-15,17,19-20,26H,5,7-13H2,1-4H3/t14-,15-,17+,19+,20+,22-,23-,24+/m0/s1 |
| InChIKey | JCSLFQHQNBJUPH-CIJMZZSOSA-N |
| XLogP | 3.28 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.35 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|