C21H32O3Si — CID 134958231
(2S)-3-[(4S)-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]-2-hydroxy-1-phenylpropan-1-one (PubChem CID 134958231) has the molecular formula C21H32O3Si and a molecular weight of 360.57 g/mol. Its IUPAC name is (2S)-3-[(4S)-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]-2-hydroxy-1-phenylpropan-1-one.
| Compound Name | (2S)-3-[(4S)-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]-2-hydroxy-1-phenylpropan-1-one |
|---|---|
| PubChem CID | 134958231 |
| Molecular Formula | C21H32O3Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | (2S)-3-[(4S)-4-[tert-butyl(dimethyl)silyl]oxycyclohexen-1-yl]-2-hydroxy-1-phenylpropan-1-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC=C(C[C@H](O)C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H32O3Si/c1-21(2,3)25(4,5)24-18-13-11-16(12-14-18)15-19(22)20(23)17-9-7-6-8-10-17/h6-11,18-19,22H,12-15H2,1-5H3/t18-,19+/m1/s1 |
| InChIKey | LTMQUSHWOYRAJX-MOPGFXCFSA-N |
| XLogP | 5.12 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|