C30H37NO2Si — CID 134982547
(6aS,10aR,10bR)-6a-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1,2,3,4,10a,10b-hexahydropyrido[1,2-b]isoindol-6-one (PubChem CID 134982547) has the molecular formula C30H37NO2Si and a molecular weight of 471.72 g/mol. Its IUPAC name is (6aS,10aR,10bR)-6a-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1,2,3,4,10a,10b-hexahydropyrido[1,2-b]isoindol-6-one.
| Compound Name | (6aS,10aR,10bR)-6a-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1,2,3,4,10a,10b-hexahydropyrido[1,2-b]isoindol-6-one |
|---|---|
| PubChem CID | 134982547 |
| Molecular Formula | C30H37NO2Si |
| Molecular Weight | 471.72 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | (6aS,10aR,10bR)-6a-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-1,2,3,4,10a,10b-hexahydropyrido[1,2-b]isoindol-6-one |
| SMILES | CC(C)(C)[Si](OCC[C@]12C=CC=C[C@H]1[C@H]1CCCCN1C2=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H37NO2Si/c1-29(2,3)34(24-14-6-4-7-15-24,25-16-8-5-9-17-25)33-23-21-30-20-12-10-18-26(30)27-19-11-13-22-31(27)28(30)32/h4-10,12,14-18,20,26-27H,11,13,19,21-23H2,1-3H3/t26-,27+,30+/m0/s1 |
| InChIKey | LZWLCKAFERSUBD-PVTPYKNESA-N |
| XLogP | 5.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.72 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|