C14H18O — CID 134992423
[(1S,4S,6R)-4-methyl-6-phenylcyclohex-2-en-1-yl]methanol (PubChem CID 134992423) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is [(1S,4S,6R)-4-methyl-6-phenylcyclohex-2-en-1-yl]methanol.
| Compound Name | [(1S,4S,6R)-4-methyl-6-phenylcyclohex-2-en-1-yl]methanol |
|---|---|
| PubChem CID | 134992423 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | [(1S,4S,6R)-4-methyl-6-phenylcyclohex-2-en-1-yl]methanol |
| SMILES | C[C@@H]1C=C[C@H](CO)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C14H18O/c1-11-7-8-13(10-15)14(9-11)12-5-3-2-4-6-12/h2-8,11,13-15H,9-10H2,1H3/t11-,13-,14+/m1/s1 |
| InChIKey | GCUBYLRTFCSZCG-BNOWGMLFSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|