C22H24N2O2S2 — CID 134998206
[(3S,4R,5S)-2,3-diphenyl-5-propyl-1,2-oxazolidin-4-yl]-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone (PubChem CID 134998206) has the molecular formula C22H24N2O2S2 and a molecular weight of 412.58 g/mol. Its IUPAC name is [(3S,4R,5S)-2,3-diphenyl-5-propyl-1,2-oxazolidin-4-yl]-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone.
| Compound Name | [(3S,4R,5S)-2,3-diphenyl-5-propyl-1,2-oxazolidin-4-yl]-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 134998206 |
| Molecular Formula | C22H24N2O2S2 |
| Molecular Weight | 412.58 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | [(3S,4R,5S)-2,3-diphenyl-5-propyl-1,2-oxazolidin-4-yl]-(2-sulfanylidene-1,3-thiazolidin-3-yl)methanone |
| SMILES | CCC[C@@H]1ON(c2ccccc2)[C@H](c2ccccc2)[C@H]1C(=O)N1CCSC1=S |
| InChI | InChI=1S/C22H24N2O2S2/c1-2-9-18-19(21(25)23-14-15-28-22(23)27)20(16-10-5-3-6-11-16)24(26-18)17-12-7-4-8-13-17/h3-8,10-13,18-20H,2,9,14-15H2,1H3/t18-,19-,20+/m0/s1 |
| InChIKey | YOPKOIVTKXRIAL-SLFFLAALSA-N |
| XLogP | 4.82 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|