C17H18N2S — CID 135011052
N-(2,6-dimethylphenyl)-3-methyl-4H-1,3-benzothiazin-2-imine (PubChem CID 135011052) has the molecular formula C17H18N2S and a molecular weight of 282.41 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-3-methyl-4H-1,3-benzothiazin-2-imine.
| Compound Name | N-(2,6-dimethylphenyl)-3-methyl-4H-1,3-benzothiazin-2-imine |
|---|---|
| PubChem CID | 135011052 |
| Molecular Formula | C17H18N2S |
| Molecular Weight | 282.41 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | N-(2,6-dimethylphenyl)-3-methyl-4H-1,3-benzothiazin-2-imine |
| SMILES | Cc1cccc(C)c1/N=C1\Sc2ccccc2CN1C |
| InChI | InChI=1S/C17H18N2S/c1-12-7-6-8-13(2)16(12)18-17-19(3)11-14-9-4-5-10-15(14)20-17/h4-10H,11H2,1-3H3/b18-17- |
| InChIKey | FAZSYUHLKPPADY-ZCXUNETKSA-N |
| XLogP | 4.53 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|