C44H48O9 — CID 135011099
2-[(5S)-2-oxo-3,4,5,7-tetrakis(phenylmethoxy)-6-prop-2-enoxyheptyl]-6,8-dioxabicyclo[3.2.1]octan-4-one (PubChem CID 135011099) has the molecular formula C44H48O9 and a molecular weight of 720.86 g/mol. Its IUPAC name is 2-[(5S)-2-oxo-3,4,5,7-tetrakis(phenylmethoxy)-6-prop-2-enoxyheptyl]-6,8-dioxabicyclo[3.2.1]octan-4-one.
| Compound Name | 2-[(5S)-2-oxo-3,4,5,7-tetrakis(phenylmethoxy)-6-prop-2-enoxyheptyl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
|---|---|
| PubChem CID | 135011099 |
| Molecular Formula | C44H48O9 |
| Molecular Weight | 720.86 g/mol |
| Exact Mass | 720.33 |
| IUPAC Name | 2-[(5S)-2-oxo-3,4,5,7-tetrakis(phenylmethoxy)-6-prop-2-enoxyheptyl]-6,8-dioxabicyclo[3.2.1]octan-4-one |
| SMILES | C=CCOC(COCc1ccccc1)[C@H](OCc1ccccc1)C(OCc1ccccc1)C(OCc1ccccc1)C(=O)CC1CC(=O)C2OCC1O2 |
| InChI | InChI=1S/C44H48O9/c1-2-23-48-40(30-47-26-32-15-7-3-8-16-32)42(50-28-34-19-11-5-12-20-34)43(51-29-35-21-13-6-14-22-35)41(49-27-33-17-9-4-10-18-33)37(45)24-36-25-38(46)44-52-31-39(36)53-44/h2-22,36,39-44H,1,23-31H2/t36?,39?,40?,41?,42-,43?,44?/m0/s1 |
| InChIKey | YCFMUTVIBPOUPB-WTFQKATLSA-N |
| XLogP | 6.82 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.86 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|