C20H25NO3S — CID 135013511
(2R,6S,8S)-2,5,5-trimethyl-10-(4-methylphenyl)sulfonyl-10-azatetracyclo[6.3.0.01,3.02,6]undecan-4-one (PubChem CID 135013511) has the molecular formula C20H25NO3S and a molecular weight of 359.49 g/mol. Its IUPAC name is (2R,6S,8S)-2,5,5-trimethyl-10-(4-methylphenyl)sulfonyl-10-azatetracyclo[6.3.0.01,3.02,6]undecan-4-one.
| Compound Name | (2R,6S,8S)-2,5,5-trimethyl-10-(4-methylphenyl)sulfonyl-10-azatetracyclo[6.3.0.01,3.02,6]undecan-4-one |
|---|---|
| PubChem CID | 135013511 |
| Molecular Formula | C20H25NO3S |
| Molecular Weight | 359.49 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (2R,6S,8S)-2,5,5-trimethyl-10-(4-methylphenyl)sulfonyl-10-azatetracyclo[6.3.0.01,3.02,6]undecan-4-one |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H]3C[C@@H]4C(C)(C)C(=O)C5C3(C2)[C@@]54C)cc1 |
| InChI | InChI=1S/C20H25NO3S/c1-12-5-7-14(8-6-12)25(23,24)21-10-13-9-15-18(2,3)17(22)16-19(15,4)20(13,16)11-21/h5-8,13,15-16H,9-11H2,1-4H3/t13-,15-,16?,19-,20?/m1/s1 |
| InChIKey | FZCKYPCVYZWLCJ-XZPWOAJXSA-N |
| XLogP | 2.87 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |