C22H28O4 — CID 135022190
(1S,2S,7R,10R,11R,12R,16S)-8,11-bis(ethenyl)-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene (PubChem CID 135022190) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (1S,2S,7R,10R,11R,12R,16S)-8,11-bis(ethenyl)-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene.
| Compound Name | (1S,2S,7R,10R,11R,12R,16S)-8,11-bis(ethenyl)-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene |
|---|---|
| PubChem CID | 135022190 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (1S,2S,7R,10R,11R,12R,16S)-8,11-bis(ethenyl)-5,5,14,14-tetramethyl-4,6,13,15-tetraoxapentacyclo[9.5.2.02,10.03,7.012,16]octadeca-8,17-diene |
| SMILES | C=CC1=C[C@@H]2[C@H](C3OC(C)(C)O[C@H]13)[C@@H]1C=C[C@@]2(C=C)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C22H28O4/c1-7-12-11-14-15(18-16(12)23-20(3,4)25-18)13-9-10-22(14,8-2)19-17(13)24-21(5,6)26-19/h7-11,13-19H,1-2H2,3-6H3/t13-,14+,15+,16+,17-,18?,19-,22+/m0/s1 |
| InChIKey | PEUOLSSQSLDXQZ-MPNLCURXSA-N |
| XLogP | 3.76 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|