C20H22O3 — CID 135023502
(1'S,6'R,8'R)-2'-phenylmethoxyspiro[oxirane-2,10'-tricyclo[6.2.2.01,6]dodec-11-ene]-9'-one (PubChem CID 135023502) has the molecular formula C20H22O3 and a molecular weight of 310.39 g/mol. Its IUPAC name is (1'S,6'R,8'R)-2'-phenylmethoxyspiro[oxirane-2,10'-tricyclo[6.2.2.01,6]dodec-11-ene]-9'-one.
| Compound Name | (1'S,6'R,8'R)-2'-phenylmethoxyspiro[oxirane-2,10'-tricyclo[6.2.2.01,6]dodec-11-ene]-9'-one |
|---|---|
| PubChem CID | 135023502 |
| Molecular Formula | C20H22O3 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | (1'S,6'R,8'R)-2'-phenylmethoxyspiro[oxirane-2,10'-tricyclo[6.2.2.01,6]dodec-11-ene]-9'-one |
| SMILES | O=C1[C@H]2C=C[C@@]3(C(OCc4ccccc4)CCC[C@@H]3C2)C12CO2 |
| InChI | InChI=1S/C20H22O3/c21-18-15-9-10-19(20(18)13-23-20)16(11-15)7-4-8-17(19)22-12-14-5-2-1-3-6-14/h1-3,5-6,9-10,15-17H,4,7-8,11-13H2/t15-,16+,17?,19+,20?/m0/s1 |
| InChIKey | AMQOOPDWWCSAJK-AYBCRXQHSA-N |
| XLogP | 3.29 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|