C30H56O5Si2 — CID 135025115
methyl (E)-3-[(1R,2R,3S,3aR,4S,5R,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-5-[3-[tert-butyl(dimethyl)silyl]oxybutyl]-3-hydroxy-2-methyl-2,3,3a,4,5,7a-hexahydro-1H-inden-4-yl]prop-2-enoate (PubChem CID 135025115) has the molecular formula C30H56O5Si2 and a molecular weight of 552.95 g/mol. Its IUPAC name is methyl (E)-3-[(1R,2R,3S,3aR,4S,5R,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-5-[3-[tert-butyl(dimethyl)silyl]oxybutyl]-3-hydroxy-2-methyl-2,3,3a,4,5,7a-hexahydro-1H-inden-4-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(1R,2R,3S,3aR,4S,5R,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-5-[3-[tert-butyl(dimethyl)silyl]oxybutyl]-3-hydroxy-2-methyl-2,3,3a,4,5,7a-hexahydro-1H-inden-4-yl]prop-2-enoate |
|---|---|
| PubChem CID | 135025115 |
| Molecular Formula | C30H56O5Si2 |
| Molecular Weight | 552.95 g/mol |
| Exact Mass | 552.37 |
| IUPAC Name | methyl (E)-3-[(1R,2R,3S,3aR,4S,5R,7aS)-1-[tert-butyl(dimethyl)silyl]oxy-5-[3-[tert-butyl(dimethyl)silyl]oxybutyl]-3-hydroxy-2-methyl-2,3,3a,4,5,7a-hexahydro-1H-inden-4-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@@H]1[C@H]2[C@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2C=C[C@H]1CCC(C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H56O5Si2/c1-20(34-36(10,11)29(3,4)5)14-15-22-16-17-24-26(23(22)18-19-25(31)33-9)27(32)21(2)28(24)35-37(12,13)30(6,7)8/h16-24,26-28,32H,14-15H2,1-13H3/b19-18+/t20?,21-,22-,23+,24+,26-,27-,28+/m1/s1 |
| InChIKey | OEMIZKHIMBHCSS-DRBLFWJHSA-N |
| XLogP | 7.34 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.95 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|