C23H23BrO2 — CID 135028496
5-[bromo(cyclohexylidene)methyl]-3,3-diphenyloxolan-2-one (PubChem CID 135028496) has the molecular formula C23H23BrO2 and a molecular weight of 411.34 g/mol. Its IUPAC name is 5-[bromo(cyclohexylidene)methyl]-3,3-diphenyloxolan-2-one.
| Compound Name | 5-[bromo(cyclohexylidene)methyl]-3,3-diphenyloxolan-2-one |
|---|---|
| PubChem CID | 135028496 |
| Molecular Formula | C23H23BrO2 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | 5-[bromo(cyclohexylidene)methyl]-3,3-diphenyloxolan-2-one |
| SMILES | O=C1OC(C(Br)=C2CCCCC2)CC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23BrO2/c24-21(17-10-4-1-5-11-17)20-16-23(22(25)26-20,18-12-6-2-7-13-18)19-14-8-3-9-15-19/h2-3,6-9,12-15,20H,1,4-5,10-11,16H2 |
| InChIKey | UCIWCJRXNMDFJJ-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |