About 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol
5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol (PubChem CID 135033807) has the molecular formula C24H23NO3
and a molecular weight of 373.45 g/mol. Its IUPAC name is 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol.
Molecular Properties
| Compound Name | 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol |
| PubChem CID | 135033807 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol |
| SMILES | COc1cc(C2(Cc3ccccc3)C(C)=Nc3ccccc32)cc(O)c1OC |
| InChI | InChI=1S/C24H23NO3/c1-16-24(15-17-9-5-4-6-10-17,19-11-7-8-12-20(19)25-16)18-13-21(26)23(28-3)22(14-18)27-2/h4-14,26H,15H2,1-3H3 |
| InChIKey | SAJHILSQCKIGKU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol?
The IUPAC name of 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol (CID 135033807) is 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol.
What is the SMILES notation for 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol?
The canonical SMILES for 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol is COc1cc(C2(Cc3ccccc3)C(C)=Nc3ccccc32)cc(O)c1OC.
What is the InChIKey of 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol?
The InChIKey is SAJHILSQCKIGKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23NO3/c1-16-24(15-17-9-5-4-6-10-17,19-11-7-8-12-20(19)25-16)18-13-21(26)23(28-3)22(14-18)27-2/h4-14,26H,15H2,1-3H3.
What are the key properties of 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol?
5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol has a molecular weight of 373.45 g/mol, XLogP of 5.04, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol is sourced from PubChem (CID 135033807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).