C24H23NO3 — CID 135033807
5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol (PubChem CID 135033807) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol.
| Compound Name | 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol |
|---|---|
| PubChem CID | 135033807 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | 5-(3-benzyl-2-methylindol-3-yl)-2,3-dimethoxyphenol |
| SMILES | COc1cc(C2(Cc3ccccc3)C(C)=Nc3ccccc32)cc(O)c1OC |
| InChI | InChI=1S/C24H23NO3/c1-16-24(15-17-9-5-4-6-10-17,19-11-7-8-12-20(19)25-16)18-13-21(26)23(28-3)22(14-18)27-2/h4-14,26H,15H2,1-3H3 |
| InChIKey | SAJHILSQCKIGKU-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |