C12H20O2 — CID 135036652
1-[(1S,2S)-2-ethenyl-1-methyl-5-[(2S)-oxiran-2-yl]cyclopentyl]ethanol (PubChem CID 135036652) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is 1-[(1S,2S)-2-ethenyl-1-methyl-5-[(2S)-oxiran-2-yl]cyclopentyl]ethanol.
| Compound Name | 1-[(1S,2S)-2-ethenyl-1-methyl-5-[(2S)-oxiran-2-yl]cyclopentyl]ethanol |
|---|---|
| PubChem CID | 135036652 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | 1-[(1S,2S)-2-ethenyl-1-methyl-5-[(2S)-oxiran-2-yl]cyclopentyl]ethanol |
| SMILES | C=C[C@@H]1CCC([C@H]2CO2)[C@@]1(C)C(C)O |
| InChI | InChI=1S/C12H20O2/c1-4-9-5-6-10(11-7-14-11)12(9,3)8(2)13/h4,8-11,13H,1,5-7H2,2-3H3/t8?,9-,10?,11-,12+/m1/s1 |
| InChIKey | UUMFSIAJZROMQL-PHNIEDBHSA-N |
| XLogP | 1.98 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|