C17H11BrF6O3S — CID 135054057
[(E)-1-bromo-3,3,3-trifluoro-1-[4-(trifluoromethyl)phenyl]prop-1-en-2-yl] 4-methylbenzenesulfonate (PubChem CID 135054057) has the molecular formula C17H11BrF6O3S and a molecular weight of 489.23 g/mol. Its IUPAC name is [(E)-1-bromo-3,3,3-trifluoro-1-[4-(trifluoromethyl)phenyl]prop-1-en-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(E)-1-bromo-3,3,3-trifluoro-1-[4-(trifluoromethyl)phenyl]prop-1-en-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 135054057 |
| Molecular Formula | C17H11BrF6O3S |
| Molecular Weight | 489.23 g/mol |
| Exact Mass | 487.95 |
| IUPAC Name | [(E)-1-bromo-3,3,3-trifluoro-1-[4-(trifluoromethyl)phenyl]prop-1-en-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O/C(=C(/Br)c2ccc(C(F)(F)F)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11BrF6O3S/c1-10-2-8-13(9-3-10)28(25,26)27-15(17(22,23)24)14(18)11-4-6-12(7-5-11)16(19,20)21/h2-9H,1H3/b15-14+ |
| InChIKey | KMNUYXGCOAQTOH-CCEZHUSRSA-N |
| XLogP | 6.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.23 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|