C11H20O4 — CID 135056753
(1S)-2-methyl-1-[2-(2-methylprop-1-enyl)-1,3-dioxolan-2-yl]propane-1,2-diol (PubChem CID 135056753) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is (1S)-2-methyl-1-[2-(2-methylprop-1-enyl)-1,3-dioxolan-2-yl]propane-1,2-diol.
| Compound Name | (1S)-2-methyl-1-[2-(2-methylprop-1-enyl)-1,3-dioxolan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 135056753 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (1S)-2-methyl-1-[2-(2-methylprop-1-enyl)-1,3-dioxolan-2-yl]propane-1,2-diol |
| SMILES | CC(C)=CC1([C@@H](O)C(C)(C)O)OCCO1 |
| InChI | InChI=1S/C11H20O4/c1-8(2)7-11(14-5-6-15-11)9(12)10(3,4)13/h7,9,12-13H,5-6H2,1-4H3/t9-/m0/s1 |
| InChIKey | NJIJCRRKKTUUDQ-VIFPVBQESA-N |
| XLogP | 0.83 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|