C16H22O3 — CID 135061408
(5R)-4-methoxy-1,6,6-trimethyl-7-prop-2-enylbicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 135061408) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is (5R)-4-methoxy-1,6,6-trimethyl-7-prop-2-enylbicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (5R)-4-methoxy-1,6,6-trimethyl-7-prop-2-enylbicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 135061408 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | (5R)-4-methoxy-1,6,6-trimethyl-7-prop-2-enylbicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | C=CCC1CC2(C)C(=O)C=C(OC)[C@H](C2=O)C1(C)C |
| InChI | InChI=1S/C16H22O3/c1-6-7-10-9-16(4)12(17)8-11(19-5)13(14(16)18)15(10,2)3/h6,8,10,13H,1,7,9H2,2-5H3/t10?,13-,16?/m1/s1 |
| InChIKey | ZTGZEOZPTBEPKE-XNVJVGRKSA-N |
| XLogP | 2.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|