C21H28O3 — CID 135061409
(5R)-6-but-3-enyl-4-methoxy-6-methyl-1,7-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 135061409) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (5R)-6-but-3-enyl-4-methoxy-6-methyl-1,7-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (5R)-6-but-3-enyl-4-methoxy-6-methyl-1,7-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 135061409 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (5R)-6-but-3-enyl-4-methoxy-6-methyl-1,7-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | C=CCCC1(C)C(CC=C)CC2(CC=C)C(=O)C=C(OC)[C@@H]1C2=O |
| InChI | InChI=1S/C21H28O3/c1-6-9-12-20(4)15(10-7-2)14-21(11-8-3)17(22)13-16(24-5)18(20)19(21)23/h6-8,13,15,18H,1-3,9-12,14H2,4-5H3/t15?,18-,20?,21?/m1/s1 |
| InChIKey | LNYOQTJWXPPUEC-BKVIATBMSA-N |
| XLogP | 4.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|