C18H24O3 — CID 135061410
(5R)-4-methoxy-6,6-dimethyl-1,7-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione (PubChem CID 135061410) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (5R)-4-methoxy-6,6-dimethyl-1,7-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione.
| Compound Name | (5R)-4-methoxy-6,6-dimethyl-1,7-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
|---|---|
| PubChem CID | 135061410 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (5R)-4-methoxy-6,6-dimethyl-1,7-bis(prop-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
| SMILES | C=CCC1CC2(CC=C)C(=O)C=C(OC)[C@H](C2=O)C1(C)C |
| InChI | InChI=1S/C18H24O3/c1-6-8-12-11-18(9-7-2)14(19)10-13(21-5)15(16(18)20)17(12,3)4/h6-7,10,12,15H,1-2,8-9,11H2,3-5H3/t12?,15-,18?/m1/s1 |
| InChIKey | JRJQCPAMSJTRQL-HBSPSFQMSA-N |
| XLogP | 3.47 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|