C15H11ClF3N — CID 135072828
2,2,2-trifluoro-N-[2-(2-methylphenyl)phenyl]ethanimidoyl chloride (PubChem CID 135072828) has the molecular formula C15H11ClF3N and a molecular weight of 297.71 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(2-methylphenyl)phenyl]ethanimidoyl chloride.
| Compound Name | 2,2,2-trifluoro-N-[2-(2-methylphenyl)phenyl]ethanimidoyl chloride |
|---|---|
| PubChem CID | 135072828 |
| Molecular Formula | C15H11ClF3N |
| Molecular Weight | 297.71 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(2-methylphenyl)phenyl]ethanimidoyl chloride |
| SMILES | Cc1ccccc1-c1ccccc1/N=C(\Cl)C(F)(F)F |
| InChI | InChI=1S/C15H11ClF3N/c1-10-6-2-3-7-11(10)12-8-4-5-9-13(12)20-14(16)15(17,18)19/h2-9H,1H3/b20-14- |
| InChIKey | TUEUTUSOLMVNFD-ZHZULCJRSA-N |
| XLogP | 5.49 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.71 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|