C14H26OSi — CID 135075647
(3E,4S,5S)-5-cyclohexyl-3-ethylidene-2,2,4-trimethyloxasilolane (PubChem CID 135075647) has the molecular formula C14H26OSi and a molecular weight of 238.45 g/mol. Its IUPAC name is (3E,4S,5S)-5-cyclohexyl-3-ethylidene-2,2,4-trimethyloxasilolane.
| Compound Name | (3E,4S,5S)-5-cyclohexyl-3-ethylidene-2,2,4-trimethyloxasilolane |
|---|---|
| PubChem CID | 135075647 |
| Molecular Formula | C14H26OSi |
| Molecular Weight | 238.45 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (3E,4S,5S)-5-cyclohexyl-3-ethylidene-2,2,4-trimethyloxasilolane |
| SMILES | C/C=C1\[C@@H](C)[C@H](C2CCCCC2)O[Si]1(C)C |
| InChI | InChI=1S/C14H26OSi/c1-5-13-11(2)14(15-16(13,3)4)12-9-7-6-8-10-12/h5,11-12,14H,6-10H2,1-4H3/b13-5+/t11-,14-/m1/s1 |
| InChIKey | KVMHJBASZDCXGO-SRZPQLRKSA-N |
| XLogP | 4.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.45 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|