C8H10N4O2 — CID 135083114
4,7-dimethoxybenzotriazol-1-amine (PubChem CID 135083114) has the molecular formula C8H10N4O2 and a molecular weight of 194.19 g/mol. Its IUPAC name is 4,7-dimethoxybenzotriazol-1-amine.
| Compound Name | 4,7-dimethoxybenzotriazol-1-amine |
|---|---|
| PubChem CID | 135083114 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 4,7-dimethoxybenzotriazol-1-amine |
| SMILES | COc1ccc(OC)c2c1nnn2N |
| InChI | InChI=1S/C8H10N4O2/c1-13-5-3-4-6(14-2)8-7(5)10-11-12(8)9/h3-4H,9H2,1-2H3 |
| InChIKey | UIPDTPXCCKFICU-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |