C22H36FN3O2S2 — CID 135127145
2-fluoro-2-methyl-N-[6-oxo-6-[2-(pyridin-2-yldisulfanyl)ethylamino]hexyl]octanamide (PubChem CID 135127145) has the molecular formula C22H36FN3O2S2 and a molecular weight of 457.68 g/mol. Its IUPAC name is 2-fluoro-2-methyl-N-[6-oxo-6-[2-(pyridin-2-yldisulfanyl)ethylamino]hexyl]octanamide.
| Compound Name | 2-fluoro-2-methyl-N-[6-oxo-6-[2-(pyridin-2-yldisulfanyl)ethylamino]hexyl]octanamide |
|---|---|
| PubChem CID | 135127145 |
| Molecular Formula | C22H36FN3O2S2 |
| Molecular Weight | 457.68 g/mol |
| Exact Mass | 457.22 |
| IUPAC Name | 2-fluoro-2-methyl-N-[6-oxo-6-[2-(pyridin-2-yldisulfanyl)ethylamino]hexyl]octanamide |
| SMILES | CCCCCCC(C)(F)C(=O)NCCCCCC(=O)NCCSSc1ccccn1 |
| InChI | InChI=1S/C22H36FN3O2S2/c1-3-4-5-9-14-22(2,23)21(28)26-16-10-6-7-12-19(27)24-17-18-29-30-20-13-8-11-15-25-20/h8,11,13,15H,3-7,9-10,12,14,16-18H2,1-2H3,(H,24,27)(H,26,28) |
| InChIKey | UDVLJNCSJWZBIJ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.68 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|