C21H22N6O — CID 135142663
2-[4-[4-(2,4-dimethyl-1,3-oxazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile (PubChem CID 135142663) has the molecular formula C21H22N6O and a molecular weight of 374.45 g/mol. Its IUPAC name is 2-[4-[4-(2,4-dimethyl-1,3-oxazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile.
| Compound Name | 2-[4-[4-(2,4-dimethyl-1,3-oxazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile |
|---|---|
| PubChem CID | 135142663 |
| Molecular Formula | C21H22N6O |
| Molecular Weight | 374.45 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 2-[4-[4-(2,4-dimethyl-1,3-oxazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]cyclohexyl]acetonitrile |
| SMILES | Cc1nc(C)c(-c2nc3cnc4[nH]ccc4c3n2C2CCC(CC#N)CC2)o1 |
| InChI | InChI=1S/C21H22N6O/c1-12-19(28-13(2)25-12)21-26-17-11-24-20-16(8-10-23-20)18(17)27(21)15-5-3-14(4-6-15)7-9-22/h8,10-11,14-15H,3-7H2,1-2H3,(H,23,24) |
| InChIKey | BJBCPAKXBRKQPV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 96.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.45 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |