C21H33N — CID 135198904
N-[(5E)-3-[(Z)-but-2-enyl]-4-methylidene-6-propyldeca-1,5,9-trien-2-yl]propan-2-imine (PubChem CID 135198904) has the molecular formula C21H33N and a molecular weight of 299.50 g/mol. Its IUPAC name is N-[(5E)-3-[(Z)-but-2-enyl]-4-methylidene-6-propyldeca-1,5,9-trien-2-yl]propan-2-imine.
| Compound Name | N-[(5E)-3-[(Z)-but-2-enyl]-4-methylidene-6-propyldeca-1,5,9-trien-2-yl]propan-2-imine |
|---|---|
| PubChem CID | 135198904 |
| Molecular Formula | C21H33N |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | N-[(5E)-3-[(Z)-but-2-enyl]-4-methylidene-6-propyldeca-1,5,9-trien-2-yl]propan-2-imine |
| SMILES | C=CCC/C(=C/C(=C)C(C/C=C\C)C(=C)N=C(C)C)CCC |
| InChI | InChI=1S/C21H33N/c1-8-11-14-20(13-10-3)16-18(6)21(15-12-9-2)19(7)22-17(4)5/h8-9,12,16,21H,1,6-7,10-11,13-15H2,2-5H3/b12-9-,20-16+ |
| InChIKey | BOSPYSWCIXFVEJ-IDMLAMRTSA-N |
| XLogP | 6.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|