C28H48N4O11 — CID 135210952
(2S)-2-[[2-[[(1S)-1-carboxypentyl]carbamoyl-[2-oxo-2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylamino]ethyl]amino]acetyl]amino]hexanoic acid (PubChem CID 135210952) has the molecular formula C28H48N4O11 and a molecular weight of 616.71 g/mol. Its IUPAC name is (2S)-2-[[2-[[(1S)-1-carboxypentyl]carbamoyl-[2-oxo-2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylamino]ethyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[2-[[(1S)-1-carboxypentyl]carbamoyl-[2-oxo-2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylamino]ethyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 135210952 |
| Molecular Formula | C28H48N4O11 |
| Molecular Weight | 616.71 g/mol |
| Exact Mass | 616.33 |
| IUPAC Name | (2S)-2-[[2-[[(1S)-1-carboxypentyl]carbamoyl-[2-oxo-2-[2-[2-[2-(2-prop-2-ynoxyethoxy)ethoxy]ethoxy]ethylamino]ethyl]amino]acetyl]amino]hexanoic acid |
| SMILES | C#CCOCCOCCOCCOCCNC(=O)CN(CC(=O)N[C@@H](CCCC)C(=O)O)C(=O)N[C@@H](CCCC)C(=O)O |
| InChI | InChI=1S/C28H48N4O11/c1-4-7-9-22(26(35)36)30-25(34)21-32(28(39)31-23(27(37)38)10-8-5-2)20-24(33)29-11-13-41-15-17-43-19-18-42-16-14-40-12-6-3/h3,22-23H,4-5,7-21H2,1-2H3,(H,29,33)(H,30,34)(H,31,39)(H,35,36)(H,37,38)/t22-,23-/m0/s1 |
| InChIKey | STXPPJYOCQHCLV-GOTSBHOMSA-N |
| XLogP | 0.22 |
| TPSA | 202.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.71 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|