C13H30N4O4 — CID 135221889
N',N'-bis(aminomethyl)methanediamine;decanedioic acid (PubChem CID 135221889) has the molecular formula C13H30N4O4 and a molecular weight of 306.41 g/mol. Its IUPAC name is N',N'-bis(aminomethyl)methanediamine;decanedioic acid.
| Compound Name | N',N'-bis(aminomethyl)methanediamine;decanedioic acid |
|---|---|
| PubChem CID | 135221889 |
| Molecular Formula | C13H30N4O4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | N',N'-bis(aminomethyl)methanediamine;decanedioic acid |
| SMILES | NCN(CN)CN.O=C(O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C10H18O4.C3H12N4/c11-9(12)7-5-3-1-2-4-6-8-10(13)14;4-1-7(2-5)3-6/h1-8H2,(H,11,12)(H,13,14);1-6H2 |
| InChIKey | PDKZLUUFKBZMOQ-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 155.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|