C20H23FN2O3S — CID 135228571
1-(1,3-benzodioxol-5-yl)-N-[[(3R)-5-(4-fluorophenyl)thiomorpholin-3-yl]methoxymethyl]methanamine (PubChem CID 135228571) has the molecular formula C20H23FN2O3S and a molecular weight of 390.48 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N-[[(3R)-5-(4-fluorophenyl)thiomorpholin-3-yl]methoxymethyl]methanamine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N-[[(3R)-5-(4-fluorophenyl)thiomorpholin-3-yl]methoxymethyl]methanamine |
|---|---|
| PubChem CID | 135228571 |
| Molecular Formula | C20H23FN2O3S |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N-[[(3R)-5-(4-fluorophenyl)thiomorpholin-3-yl]methoxymethyl]methanamine |
| SMILES | Fc1ccc(C2CSC[C@@H](COCNCc3ccc4c(c3)OCO4)N2)cc1 |
| InChI | InChI=1S/C20H23FN2O3S/c21-16-4-2-15(3-5-16)18-11-27-10-17(23-18)9-24-12-22-8-14-1-6-19-20(7-14)26-13-25-19/h1-7,17-18,22-23H,8-13H2/t17-,18?/m1/s1 |
| InChIKey | OLUFVHXHAJYNOB-QNSVNVJESA-N |
| XLogP | 3.06 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|