C21H32N6O4S — CID 135233666
N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]-2-(1,3,2,4-dioxathiazinan-4-yl)acetamide (PubChem CID 135233666) has the molecular formula C21H32N6O4S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]-2-(1,3,2,4-dioxathiazinan-4-yl)acetamide.
| Compound Name | N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]-2-(1,3,2,4-dioxathiazinan-4-yl)acetamide |
|---|---|
| PubChem CID | 135233666 |
| Molecular Formula | C21H32N6O4S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | N-[4-[5-(2,2-dimethylpropylamino)-6-[methyl(nitroso)amino]-2-pyridinyl]cyclohex-3-en-1-yl]-2-(1,3,2,4-dioxathiazinan-4-yl)acetamide |
| SMILES | CN(N=O)c1nc(C2=CCC(NC(=O)CN3CCOSO3)CC2)ccc1NCC(C)(C)C |
| InChI | InChI=1S/C21H32N6O4S/c1-21(2,3)14-22-18-10-9-17(24-20(18)26(4)25-29)15-5-7-16(8-6-15)23-19(28)13-27-11-12-30-32-31-27/h5,9-10,16,22H,6-8,11-14H2,1-4H3,(H,23,28) |
| InChIKey | NMRROENQRCAEIK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|