C11H12ClN5O2S — CID 135239325
5-chloro-2-(4-methylpiperazin-1-yl)-6-nitro-[1,3]thiazolo[4,5-b]pyridine (PubChem CID 135239325) has the molecular formula C11H12ClN5O2S and a molecular weight of 313.77 g/mol. Its IUPAC name is 5-chloro-2-(4-methylpiperazin-1-yl)-6-nitro-[1,3]thiazolo[4,5-b]pyridine.
| Compound Name | 5-chloro-2-(4-methylpiperazin-1-yl)-6-nitro-[1,3]thiazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 135239325 |
| Molecular Formula | C11H12ClN5O2S |
| Molecular Weight | 313.77 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 5-chloro-2-(4-methylpiperazin-1-yl)-6-nitro-[1,3]thiazolo[4,5-b]pyridine |
| SMILES | CN1CCN(c2nc3nc(Cl)c([N+](=O)[O-])cc3s2)CC1 |
| InChI | InChI=1S/C11H12ClN5O2S/c1-15-2-4-16(5-3-15)11-14-10-8(20-11)6-7(17(18)19)9(12)13-10/h6H,2-5H2,1H3 |
| InChIKey | BSXFYDPJHVQREA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 75.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.77 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|