C18H26O5S — CID 135242607
(2S)-3-[(2S,4R)-3-(benzenesulfonylmethyl)-2-hydroxy-4-prop-2-enylcyclopentyl]propane-1,2-diol (PubChem CID 135242607) has the molecular formula C18H26O5S and a molecular weight of 354.47 g/mol. Its IUPAC name is (2S)-3-[(2S,4R)-3-(benzenesulfonylmethyl)-2-hydroxy-4-prop-2-enylcyclopentyl]propane-1,2-diol.
| Compound Name | (2S)-3-[(2S,4R)-3-(benzenesulfonylmethyl)-2-hydroxy-4-prop-2-enylcyclopentyl]propane-1,2-diol |
|---|---|
| PubChem CID | 135242607 |
| Molecular Formula | C18H26O5S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | (2S)-3-[(2S,4R)-3-(benzenesulfonylmethyl)-2-hydroxy-4-prop-2-enylcyclopentyl]propane-1,2-diol |
| SMILES | C=CC[C@@H]1CC(C[C@H](O)CO)[C@H](O)C1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H26O5S/c1-2-6-13-9-14(10-15(20)11-19)18(21)17(13)12-24(22,23)16-7-4-3-5-8-16/h2-5,7-8,13-15,17-21H,1,6,9-12H2/t13-,14?,15+,17?,18+/m1/s1 |
| InChIKey | IFKZWDYVVODEIL-LNHOEBPRSA-N |
| XLogP | 1.39 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|